C22H29ClN4O3S — CID 18367148
4-[3-oxo-3-[6-(propan-2-ylsulfonylamino)-3,4-dihydro-2H-quinolin-1-yl]propyl]benzenecarboximidamide;hydrochloride (PubChem CID 18367148) has the molecular formula C22H29ClN4O3S and a molecular weight of 465.02 g/mol. Its IUPAC name is 4-[3-oxo-3-[6-(propan-2-ylsulfonylamino)-3,4-dihydro-2H-quinolin-1-yl]propyl]benzenecarboximidamide;hydrochloride.
| Compound Name | 4-[3-oxo-3-[6-(propan-2-ylsulfonylamino)-3,4-dihydro-2H-quinolin-1-yl]propyl]benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 18367148 |
| Molecular Formula | C22H29ClN4O3S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 4-[3-oxo-3-[6-(propan-2-ylsulfonylamino)-3,4-dihydro-2H-quinolin-1-yl]propyl]benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CCC(=O)N2CCCc3cc(NS(=O)(=O)C(C)C)ccc32)cc1 |
| InChI | InChI=1S/C22H28N4O3S.ClH/c1-15(2)30(28,29)25-19-10-11-20-18(14-19)4-3-13-26(20)21(27)12-7-16-5-8-17(9-6-16)22(23)24;/h5-6,8-11,14-15,25H,3-4,7,12-13H2,1-2H3,(H3,23,24);1H |
| InChIKey | KXEUIIQTRPIOFD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|