C26H28N4O — CID 18366975
4-[3-[6-(benzylamino)-3,4-dihydro-2H-quinolin-1-yl]-3-oxopropyl]benzenecarboximidamide (PubChem CID 18366975) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 4-[3-[6-(benzylamino)-3,4-dihydro-2H-quinolin-1-yl]-3-oxopropyl]benzenecarboximidamide.
| Compound Name | 4-[3-[6-(benzylamino)-3,4-dihydro-2H-quinolin-1-yl]-3-oxopropyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18366975 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 4-[3-[6-(benzylamino)-3,4-dihydro-2H-quinolin-1-yl]-3-oxopropyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)N2CCCc3cc(NCc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C26H28N4O/c27-26(28)21-11-8-19(9-12-21)10-15-25(31)30-16-4-7-22-17-23(13-14-24(22)30)29-18-20-5-2-1-3-6-20/h1-3,5-6,8-9,11-14,17,29H,4,7,10,15-16,18H2,(H3,27,28) |
| InChIKey | RKMLXODAVXSVAO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|