C33H34N4O5S — CID 70239232
ethyl 2-[[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]-naphthalen-2-ylsulfonylamino]acetate (PubChem CID 70239232) has the molecular formula C33H34N4O5S and a molecular weight of 598.73 g/mol. Its IUPAC name is ethyl 2-[[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]-naphthalen-2-ylsulfonylamino]acetate.
| Compound Name | ethyl 2-[[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]-naphthalen-2-ylsulfonylamino]acetate |
|---|---|
| PubChem CID | 70239232 |
| Molecular Formula | C33H34N4O5S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | ethyl 2-[[1-[3-(4-carbamimidoylphenyl)propanoyl]-3,4-dihydro-2H-quinolin-6-yl]-naphthalen-2-ylsulfonylamino]acetate |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)N2CCCc3cc(N(CC(=O)OCC)S(=O)(=O)c4ccc5ccccc5c4)ccc32)cc1 |
| InChI | InChI=1S/C33H34N4O5S/c1-2-42-32(39)22-37(43(40,41)29-16-14-24-6-3-4-7-26(24)21-29)28-15-17-30-27(20-28)8-5-19-36(30)31(38)18-11-23-9-12-25(13-10-23)33(34)35/h3-4,6-7,9-10,12-17,20-21H,2,5,8,11,18-19,22H2,1H3,(H3,34,35) |
| InChIKey | SROHJNFGYMLMPX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|