C22H20N2O4S — CID 100533244
ethyl 2-[4-(cyanomethyl)-N-naphthalen-2-ylsulfonylanilino]acetate (PubChem CID 100533244) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is ethyl 2-[4-(cyanomethyl)-N-naphthalen-2-ylsulfonylanilino]acetate.
| Compound Name | ethyl 2-[4-(cyanomethyl)-N-naphthalen-2-ylsulfonylanilino]acetate |
|---|---|
| PubChem CID | 100533244 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | ethyl 2-[4-(cyanomethyl)-N-naphthalen-2-ylsulfonylanilino]acetate |
| SMILES | CCOC(=O)CN(c1ccc(CC#N)cc1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H20N2O4S/c1-2-28-22(25)16-24(20-10-7-17(8-11-20)13-14-23)29(26,27)21-12-9-18-5-3-4-6-19(18)15-21/h3-12,15H,2,13,16H2,1H3 |
| InChIKey | GMGSXMOVKXHHQQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |