C23H26N2O2 — CID 70564957
(E)-4-[4-(diethylamino)phenyl]-1-(3-ethyl-1,3-benzoxazol-2-ylidene)but-3-en-2-one (PubChem CID 70564957) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (E)-4-[4-(diethylamino)phenyl]-1-(3-ethyl-1,3-benzoxazol-2-ylidene)but-3-en-2-one.
| Compound Name | (E)-4-[4-(diethylamino)phenyl]-1-(3-ethyl-1,3-benzoxazol-2-ylidene)but-3-en-2-one |
|---|---|
| PubChem CID | 70564957 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (E)-4-[4-(diethylamino)phenyl]-1-(3-ethyl-1,3-benzoxazol-2-ylidene)but-3-en-2-one |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)C=C2Oc3ccccc3N2CC)cc1 |
| InChI | InChI=1S/C23H26N2O2/c1-4-24(5-2)19-14-11-18(12-15-19)13-16-20(26)17-23-25(6-3)21-9-7-8-10-22(21)27-23/h7-17H,4-6H2,1-3H3/b16-13+,23-17? |
| InChIKey | XYXRCLQEXNHOEB-HWTMHVFKSA-N |
| XLogP | 4.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|