C25H26ClN3O7S2 — CID 58906070
3-[5-chloro-2-[2-[3-[2-(2-hydroxyethoxy)ethyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid (PubChem CID 58906070) has the molecular formula C25H26ClN3O7S2 and a molecular weight of 580.08 g/mol. Its IUPAC name is 3-[5-chloro-2-[2-[3-[2-(2-hydroxyethoxy)ethyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-chloro-2-[2-[3-[2-(2-hydroxyethoxy)ethyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58906070 |
| Molecular Formula | C25H26ClN3O7S2 |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | 3-[5-chloro-2-[2-[3-[2-(2-hydroxyethoxy)ethyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
| SMILES | O=C1C(=CC=C2Oc3ccc(Cl)cc3N2CCCS(=O)(=O)O)N(CCOCCO)C(=S)N1c1ccccc1 |
| InChI | InChI=1S/C25H26ClN3O7S2/c26-18-7-9-22-21(17-18)27(11-4-16-38(32,33)34)23(36-22)10-8-20-24(31)29(19-5-2-1-3-6-19)25(37)28(20)12-14-35-15-13-30/h1-3,5-10,17,30H,4,11-16H2,(H,32,33,34) |
| InChIKey | IBLQEAKJHRGJAB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|