C27H35N3O7S2 — CID 6478402
3-[(2E)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-5-methoxy-1,3-benzoxazol-3-yl]propane-1-sulfonic acid (PubChem CID 6478402) has the molecular formula C27H35N3O7S2 and a molecular weight of 577.73 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-5-methoxy-1,3-benzoxazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-5-methoxy-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 6478402 |
| Molecular Formula | C27H35N3O7S2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | 3-[(2E)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-5-methoxy-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCCCN1C(=O)C(=C/C=C/C=C2/Oc3ccc(OC)cc3N2CCCS(=O)(=O)O)C(=O)N(CCCC)C1=S |
| InChI | InChI=1S/C27H35N3O7S2/c1-4-6-15-29-25(31)21(26(32)30(27(29)38)16-7-5-2)11-8-9-12-24-28(17-10-18-39(33,34)35)22-19-20(36-3)13-14-23(22)37-24/h8-9,11-14,19H,4-7,10,15-18H2,1-3H3,(H,33,34,35)/b9-8+,24-12+ |
| InChIKey | QYWWGNLZAXZTTA-DDCKGDAVSA-N |
| XLogP | 4.05 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|