C28H35N3O6S2 — CID 6478399
3-[(2E)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-5-phenyl-1,3-oxazol-3-yl]propane-1-sulfonic acid (PubChem CID 6478399) has the molecular formula C28H35N3O6S2 and a molecular weight of 573.74 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-5-phenyl-1,3-oxazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-5-phenyl-1,3-oxazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 6478399 |
| Molecular Formula | C28H35N3O6S2 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 3-[(2E)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-5-phenyl-1,3-oxazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCCCN1C(=O)C(=C/C=C/C=C2/OC(c3ccccc3)=CN2CCCS(=O)(=O)O)C(=O)N(CCCC)C1=S |
| InChI | InChI=1S/C28H35N3O6S2/c1-3-5-18-30-26(32)23(27(33)31(28(30)38)19-6-4-2)15-10-11-16-25-29(17-12-20-39(34,35)36)21-24(37-25)22-13-8-7-9-14-22/h7-11,13-16,21H,3-6,12,17-20H2,1-2H3,(H,34,35,36)/b11-10+,25-16+ |
| InChIKey | CGZMHAQAHDVDPH-WUJKDDKCSA-N |
| XLogP | 4.47 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|