C31H32N2O3S — CID 132537168
1,3-dibutyl-5-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 132537168) has the molecular formula C31H32N2O3S and a molecular weight of 512.68 g/mol. Its IUPAC name is 1,3-dibutyl-5-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-dibutyl-5-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 132537168 |
| Molecular Formula | C31H32N2O3S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 1,3-dibutyl-5-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCCN1C(=O)C(=CC=C2C=C(c3ccccc3)OC(c3ccccc3)=C2)C(=O)N(CCCC)C1=S |
| InChI | InChI=1S/C31H32N2O3S/c1-3-5-19-32-29(34)26(30(35)33(31(32)37)20-6-4-2)18-17-23-21-27(24-13-9-7-10-14-24)36-28(22-23)25-15-11-8-12-16-25/h7-18,21-22H,3-6,19-20H2,1-2H3 |
| InChIKey | WWNAPSRZJSAFIK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|