C22H23N2O+ — CID 102472285
3-[2-(2,6-diphenylpyran-4-ylidene)ethylideneamino]propylazanium (PubChem CID 102472285) has the molecular formula C22H23N2O+ and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-[2-(2,6-diphenylpyran-4-ylidene)ethylideneamino]propylazanium.
| Compound Name | 3-[2-(2,6-diphenylpyran-4-ylidene)ethylideneamino]propylazanium |
|---|---|
| PubChem CID | 102472285 |
| Molecular Formula | C22H23N2O+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 3-[2-(2,6-diphenylpyran-4-ylidene)ethylideneamino]propylazanium |
| SMILES | [NH3+]CCC/N=C/C=C1C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C22H22N2O/c23-13-7-14-24-15-12-18-16-21(19-8-3-1-4-9-19)25-22(17-18)20-10-5-2-6-11-20/h1-6,8-12,15-17H,7,13-14,23H2/p+1/b24-15+ |
| InChIKey | NBSSVWCGASSFLY-BUVRLJJBSA-O |
| XLogP | 3.73 |
| TPSA | 49.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|