C39H29ClO6 — CID 139796304
4-[5-(2,6-diphenylpyran-4-ylidene)penta-1,3-dienyl]-2,6-diphenylpyrylium perchlorate (PubChem CID 139796304) has the molecular formula C39H29ClO6 and a molecular weight of 629.11 g/mol. Its IUPAC name is 4-[5-(2,6-diphenylpyran-4-ylidene)penta-1,3-dienyl]-2,6-diphenylpyrylium perchlorate.
| Compound Name | 4-[5-(2,6-diphenylpyran-4-ylidene)penta-1,3-dienyl]-2,6-diphenylpyrylium perchlorate |
|---|---|
| PubChem CID | 139796304 |
| Molecular Formula | C39H29ClO6 |
| Molecular Weight | 629.11 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | 4-[5-(2,6-diphenylpyran-4-ylidene)penta-1,3-dienyl]-2,6-diphenylpyrylium perchlorate |
| SMILES | C(=CC=C1C=C(c2ccccc2)OC(c2ccccc2)=C1)C=Cc1cc(-c2ccccc2)[o+]c(-c2ccccc2)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C39H29O2.ClHO4/c1(6-16-30-26-36(32-18-8-2-9-19-32)40-37(27-30)33-20-10-3-11-21-33)7-17-31-28-38(34-22-12-4-13-23-34)41-39(29-31)35-24-14-5-15-25-35;2-1(3,4)5/h1-29H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | GAGWKZFZDLLOEN-UHFFFAOYSA-M |
| XLogP | 5.75 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.11 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|