C42H28I2O4 — CID 58725899
2-[[2-(4-iodophenyl)-6-(2-methylphenyl)pyran-4-ylidene]methyl]-4-[[2-(4-iodophenyl)-6-(2-methylphenyl)pyrylium-4-yl]methylidene]-3-oxocyclobuten-1-olate (PubChem CID 58725899) has the molecular formula C42H28I2O4 and a molecular weight of 850.49 g/mol. Its IUPAC name is 2-[[2-(4-iodophenyl)-6-(2-methylphenyl)pyran-4-ylidene]methyl]-4-[[2-(4-iodophenyl)-6-(2-methylphenyl)pyrylium-4-yl]methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | 2-[[2-(4-iodophenyl)-6-(2-methylphenyl)pyran-4-ylidene]methyl]-4-[[2-(4-iodophenyl)-6-(2-methylphenyl)pyrylium-4-yl]methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 58725899 |
| Molecular Formula | C42H28I2O4 |
| Molecular Weight | 850.49 g/mol |
| Exact Mass | 850.01 |
| IUPAC Name | 2-[[2-(4-iodophenyl)-6-(2-methylphenyl)pyran-4-ylidene]methyl]-4-[[2-(4-iodophenyl)-6-(2-methylphenyl)pyrylium-4-yl]methylidene]-3-oxocyclobuten-1-olate |
| SMILES | Cc1ccccc1C1=CC(=CC2=C([O-])C(=Cc3cc(-c4ccc(I)cc4)[o+]c(-c4ccccc4C)c3)C2=O)C=C(c2ccc(I)cc2)O1 |
| InChI | InChI=1S/C42H28I2O4/c1-25-7-3-5-9-33(25)39-23-27(21-37(47-39)29-11-15-31(43)16-12-29)19-35-41(45)36(42(35)46)20-28-22-38(30-13-17-32(44)18-14-30)48-40(24-28)34-10-6-4-8-26(34)2/h3-24H,1-2H3 |
| InChIKey | UUYBWZIORDUUGE-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.49 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|