C22H22O4 — CID 58741839
2-[(2-ethyl-6-methylpyran-4-ylidene)methyl]-4-[(2-ethyl-6-methylpyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate (PubChem CID 58741839) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is 2-[(2-ethyl-6-methylpyran-4-ylidene)methyl]-4-[(2-ethyl-6-methylpyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | 2-[(2-ethyl-6-methylpyran-4-ylidene)methyl]-4-[(2-ethyl-6-methylpyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 58741839 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[(2-ethyl-6-methylpyran-4-ylidene)methyl]-4-[(2-ethyl-6-methylpyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CCC1=CC(=CC2=C([O-])C(=Cc3cc(C)[o+]c(CC)c3)C2=O)C=C(C)O1 |
| InChI | InChI=1S/C22H22O4/c1-5-17-9-15(7-13(3)25-17)11-19-21(23)20(22(19)24)12-16-8-14(4)26-18(6-2)10-16/h7-12H,5-6H2,1-4H3 |
| InChIKey | ZQJKRTZYZJJTTO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|