C20H18O2S2 — CID 22942793
(4Z)-2-[(2,6-dimethylthiopyran-4-ylidene)methyl]-4-[(2,6-dimethylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate (PubChem CID 22942793) has the molecular formula C20H18O2S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is (4Z)-2-[(2,6-dimethylthiopyran-4-ylidene)methyl]-4-[(2,6-dimethylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | (4Z)-2-[(2,6-dimethylthiopyran-4-ylidene)methyl]-4-[(2,6-dimethylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 22942793 |
| Molecular Formula | C20H18O2S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (4Z)-2-[(2,6-dimethylthiopyran-4-ylidene)methyl]-4-[(2,6-dimethylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CC1=CC(=CC2=C([O-])/C(=C/c3cc(C)[s+]c(C)c3)C2=O)C=C(C)S1 |
| InChI | InChI=1S/C20H18O2S2/c1-11-5-15(6-12(2)23-11)9-17-19(21)18(20(17)22)10-16-7-13(3)24-14(4)8-16/h5-10H,1-4H3 |
| InChIKey | ZIFCTSSYYSCFPF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|