C41H28O2S2 — CID 59817209
2-[1-(2,6-diphenylthiopyran-4-ylidene)ethyl]-4-[(2,6-diphenylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate (PubChem CID 59817209) has the molecular formula C41H28O2S2 and a molecular weight of 616.81 g/mol. Its IUPAC name is 2-[1-(2,6-diphenylthiopyran-4-ylidene)ethyl]-4-[(2,6-diphenylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | 2-[1-(2,6-diphenylthiopyran-4-ylidene)ethyl]-4-[(2,6-diphenylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 59817209 |
| Molecular Formula | C41H28O2S2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | 2-[1-(2,6-diphenylthiopyran-4-ylidene)ethyl]-4-[(2,6-diphenylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CC(=C1C=C(c2ccccc2)SC(c2ccccc2)=C1)C1=C([O-])C(=Cc2cc(-c3ccccc3)[s+]c(-c3ccccc3)c2)C1=O |
| InChI | InChI=1S/C41H28O2S2/c1-27(33-25-37(31-18-10-4-11-19-31)45-38(26-33)32-20-12-5-13-21-32)39-40(42)34(41(39)43)22-28-23-35(29-14-6-2-7-15-29)44-36(24-28)30-16-8-3-9-17-30/h2-26H,1H3 |
| InChIKey | VGDOPEKDVUIAFP-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|