C33H23S4+ — CID 140811351
4-[(E)-3-(2,6-diphenylthiopyrylium-4-yl)prop-2-enylidene]-2,6-dithiophen-2-ylthiopyran (PubChem CID 140811351) has the molecular formula C33H23S4+ and a molecular weight of 547.82 g/mol. Its IUPAC name is 4-[(E)-3-(2,6-diphenylthiopyrylium-4-yl)prop-2-enylidene]-2,6-dithiophen-2-ylthiopyran.
| Compound Name | 4-[(E)-3-(2,6-diphenylthiopyrylium-4-yl)prop-2-enylidene]-2,6-dithiophen-2-ylthiopyran |
|---|---|
| PubChem CID | 140811351 |
| Molecular Formula | C33H23S4+ |
| Molecular Weight | 547.82 g/mol |
| Exact Mass | 547.07 |
| IUPAC Name | 4-[(E)-3-(2,6-diphenylthiopyrylium-4-yl)prop-2-enylidene]-2,6-dithiophen-2-ylthiopyran |
| SMILES | C(/C=C/c1cc(-c2ccccc2)[s+]c(-c2ccccc2)c1)=C1C=C(c2cccs2)SC(c2cccs2)=C1 |
| InChI | InChI=1S/C33H23S4/c1-3-12-26(13-4-1)30-20-24(21-31(36-30)27-14-5-2-6-15-27)10-7-11-25-22-32(28-16-8-18-34-28)37-33(23-25)29-17-9-19-35-29/h1-23H/q+1 |
| InChIKey | OHDLHAPSRDLEIT-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.82 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|