C31H21S6+ — CID 140811325
4-[(1E,3E)-5-(2,6-dithiophen-2-ylthiopyran-4-ylidene)penta-1,3-dienyl]-2,6-dithiophen-2-ylthiopyrylium (PubChem CID 140811325) has the molecular formula C31H21S6+ and a molecular weight of 585.91 g/mol. Its IUPAC name is 4-[(1E,3E)-5-(2,6-dithiophen-2-ylthiopyran-4-ylidene)penta-1,3-dienyl]-2,6-dithiophen-2-ylthiopyrylium.
| Compound Name | 4-[(1E,3E)-5-(2,6-dithiophen-2-ylthiopyran-4-ylidene)penta-1,3-dienyl]-2,6-dithiophen-2-ylthiopyrylium |
|---|---|
| PubChem CID | 140811325 |
| Molecular Formula | C31H21S6+ |
| Molecular Weight | 585.91 g/mol |
| Exact Mass | 585.00 |
| IUPAC Name | 4-[(1E,3E)-5-(2,6-dithiophen-2-ylthiopyran-4-ylidene)penta-1,3-dienyl]-2,6-dithiophen-2-ylthiopyrylium |
| SMILES | C(/C=C/C=C/c1cc(-c2cccs2)[s+]c(-c2cccs2)c1)=C1C=C(c2cccs2)SC(c2cccs2)=C1 |
| InChI | InChI=1S/C31H21S6/c1(2-8-22-18-28(24-10-4-14-32-24)36-29(19-22)25-11-5-15-33-25)3-9-23-20-30(26-12-6-16-34-26)37-31(21-23)27-13-7-17-35-27/h1-21H/q+1 |
| InChIKey | RXUPUUVMHOLGJD-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.91 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|