C12H8S4 — CID 86180239
3,6-dithiophen-2-yldithiine (PubChem CID 86180239) has the molecular formula C12H8S4 and a molecular weight of 280.46 g/mol. Its IUPAC name is 3,6-dithiophen-2-yldithiine.
| Compound Name | 3,6-dithiophen-2-yldithiine |
|---|---|
| PubChem CID | 86180239 |
| Molecular Formula | C12H8S4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | 3,6-dithiophen-2-yldithiine |
| SMILES | C1=C(c2cccs2)SSC(c2cccs2)=C1 |
| InChI | InChI=1S/C12H8S4/c1-3-9(13-7-1)11-5-6-12(16-15-11)10-4-2-8-14-10/h1-8H |
| InChIKey | TZOSHEUMEAPNPI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|