About 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole
2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole (PubChem CID 15150343) has the molecular formula C10H6S5
and a molecular weight of 286.49 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole.
Analyze 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole?
The IUPAC name of 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole (CID 15150343) is 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole.
What is the SMILES notation for 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole?
The canonical SMILES for 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole is C1=CSC(=C2SC=C(c3cccs3)S2)S1.
What is the InChIKey of 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole?
The InChIKey is VZOCRGMABCNQKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6S5/c1-2-7(11-3-1)8-6-14-10(15-8)9-12-4-5-13-9/h1-6H.
What are the key properties of 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole?
2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole has a molecular weight of 286.49 g/mol, XLogP of 5.60, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dithiol-2-ylidene)-4-thiophen-2-yl-1,3-dithiole is sourced from PubChem (CID 15150343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).