C20H24OS4 — CID 54237462
2-(1,3-dithiol-2-ylidene)-4-(4-octoxyphenyl)-1,3-dithiole (PubChem CID 54237462) has the molecular formula C20H24OS4 and a molecular weight of 408.68 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-4-(4-octoxyphenyl)-1,3-dithiole.
| Compound Name | 2-(1,3-dithiol-2-ylidene)-4-(4-octoxyphenyl)-1,3-dithiole |
|---|---|
| PubChem CID | 54237462 |
| Molecular Formula | C20H24OS4 |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-4-(4-octoxyphenyl)-1,3-dithiole |
| SMILES | CCCCCCCCOc1ccc(C2=CSC(=C3SC=CS3)S2)cc1 |
| InChI | InChI=1S/C20H24OS4/c1-2-3-4-5-6-7-12-21-17-10-8-16(9-11-17)18-15-24-20(25-18)19-22-13-14-23-19/h8-11,13-15H,2-7,12H2,1H3 |
| InChIKey | QNOVYNGZJUBDMZ-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|