About 2-thiophen-2-ylthiophene;triazine
2-thiophen-2-ylthiophene;triazine (PubChem CID 175444863) has the molecular formula C11H9N3S2
and a molecular weight of 247.35 g/mol. Its IUPAC name is 2-thiophen-2-ylthiophene;triazine.
Molecular Properties
| Compound Name | 2-thiophen-2-ylthiophene;triazine |
| PubChem CID | 175444863 |
| Molecular Formula | C11H9N3S2 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 2-thiophen-2-ylthiophene;triazine |
| SMILES | c1cnnnc1.c1csc(-c2cccs2)c1 |
| InChI | InChI=1S/C8H6S2.C3H3N3/c1-3-7(9-5-1)8-4-2-6-10-8;1-2-4-6-5-3-1/h1-6H;1-3H |
| InChIKey | WMCPPMGLKMQCRJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-thiophen-2-ylthiophene;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylthiophene;triazine?
The IUPAC name of 2-thiophen-2-ylthiophene;triazine (CID 175444863) is 2-thiophen-2-ylthiophene;triazine.
What is the SMILES notation for 2-thiophen-2-ylthiophene;triazine?
The canonical SMILES for 2-thiophen-2-ylthiophene;triazine is c1cnnnc1.c1csc(-c2cccs2)c1.
What is the InChIKey of 2-thiophen-2-ylthiophene;triazine?
The InChIKey is WMCPPMGLKMQCRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S2.C3H3N3/c1-3-7(9-5-1)8-4-2-6-10-8;1-2-4-6-5-3-1/h1-6H;1-3H.
What are the key properties of 2-thiophen-2-ylthiophene;triazine?
2-thiophen-2-ylthiophene;triazine has a molecular weight of 247.35 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylthiophene;triazine is sourced from PubChem (CID 175444863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).