C24H16S6 — CID 161253410
2,3-dithiophen-2-ylthiophene;2,5-dithiophen-2-ylthiophene (PubChem CID 161253410) has the molecular formula C24H16S6 and a molecular weight of 496.79 g/mol. Its IUPAC name is 2,3-dithiophen-2-ylthiophene;2,5-dithiophen-2-ylthiophene.
| Compound Name | 2,3-dithiophen-2-ylthiophene;2,5-dithiophen-2-ylthiophene |
|---|---|
| PubChem CID | 161253410 |
| Molecular Formula | C24H16S6 |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | 2,3-dithiophen-2-ylthiophene;2,5-dithiophen-2-ylthiophene |
| SMILES | c1csc(-c2ccc(-c3cccs3)s2)c1.c1csc(-c2ccsc2-c2cccs2)c1 |
| InChI | InChI=1S/2C12H8S3/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10;1-3-10(13-6-1)9-5-8-15-12(9)11-4-2-7-14-11/h2*1-8H |
| InChIKey | VBOOTTLBQDJXNW-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |