C14H10O2S2 — CID 122606222
3,6-dithiophen-2-ylbenzene-1,2-diol (PubChem CID 122606222) has the molecular formula C14H10O2S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 3,6-dithiophen-2-ylbenzene-1,2-diol.
| Compound Name | 3,6-dithiophen-2-ylbenzene-1,2-diol |
|---|---|
| PubChem CID | 122606222 |
| Molecular Formula | C14H10O2S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 3,6-dithiophen-2-ylbenzene-1,2-diol |
| SMILES | Oc1c(-c2cccs2)ccc(-c2cccs2)c1O |
| InChI | InChI=1S/C14H10O2S2/c15-13-9(11-3-1-7-17-11)5-6-10(14(13)16)12-4-2-8-18-12/h1-8,15-16H |
| InChIKey | HWSCPPXRSYKOMB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|