C20H16O2S2 — CID 22996753
2-(4,8-dimethoxy-5-thiophen-2-ylnaphthalen-1-yl)thiophene (PubChem CID 22996753) has the molecular formula C20H16O2S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-(4,8-dimethoxy-5-thiophen-2-ylnaphthalen-1-yl)thiophene.
| Compound Name | 2-(4,8-dimethoxy-5-thiophen-2-ylnaphthalen-1-yl)thiophene |
|---|---|
| PubChem CID | 22996753 |
| Molecular Formula | C20H16O2S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-(4,8-dimethoxy-5-thiophen-2-ylnaphthalen-1-yl)thiophene |
| SMILES | COc1ccc(-c2cccs2)c2c(OC)ccc(-c3cccs3)c12 |
| InChI | InChI=1S/C20H16O2S2/c1-21-15-9-7-14(18-6-4-12-24-18)20-16(22-2)10-8-13(19(15)20)17-5-3-11-23-17/h3-12H,1-2H3 |
| InChIKey | PARLVPLAHFZLGI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |