C16H14O2S2 — CID 137421749
[4-(hydroxymethyl)-2,5-dithiophen-2-ylphenyl]methanol (PubChem CID 137421749) has the molecular formula C16H14O2S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is [4-(hydroxymethyl)-2,5-dithiophen-2-ylphenyl]methanol.
| Compound Name | [4-(hydroxymethyl)-2,5-dithiophen-2-ylphenyl]methanol |
|---|---|
| PubChem CID | 137421749 |
| Molecular Formula | C16H14O2S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | [4-(hydroxymethyl)-2,5-dithiophen-2-ylphenyl]methanol |
| SMILES | OCc1cc(-c2cccs2)c(CO)cc1-c1cccs1 |
| InChI | InChI=1S/C16H14O2S2/c17-9-11-8-14(16-4-2-6-20-16)12(10-18)7-13(11)15-3-1-5-19-15/h1-8,17-18H,9-10H2 |
| InChIKey | TXHXKGHPVOLQGK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |