About 2-thiophen-2-yl-1,4-dithiine
2-thiophen-2-yl-1,4-dithiine (PubChem CID 66995291) has the molecular formula C8H6S3
and a molecular weight of 198.34 g/mol. Its IUPAC name is 2-thiophen-2-yl-1,4-dithiine.
Molecular Properties
| Compound Name | 2-thiophen-2-yl-1,4-dithiine |
| PubChem CID | 66995291 |
| Molecular Formula | C8H6S3 |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 197.96 |
| IUPAC Name | 2-thiophen-2-yl-1,4-dithiine |
| SMILES | C1=CSC(c2cccs2)=CS1 |
| InChI | InChI=1S/C8H6S3/c1-2-7(10-3-1)8-6-9-4-5-11-8/h1-6H |
| InChIKey | FPGRJPNETIPIFK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-thiophen-2-yl-1,4-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-yl-1,4-dithiine?
The IUPAC name of 2-thiophen-2-yl-1,4-dithiine (CID 66995291) is 2-thiophen-2-yl-1,4-dithiine.
What is the SMILES notation for 2-thiophen-2-yl-1,4-dithiine?
The canonical SMILES for 2-thiophen-2-yl-1,4-dithiine is C1=CSC(c2cccs2)=CS1.
What is the InChIKey of 2-thiophen-2-yl-1,4-dithiine?
The InChIKey is FPGRJPNETIPIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S3/c1-2-7(10-3-1)8-6-9-4-5-11-8/h1-6H.
What are the key properties of 2-thiophen-2-yl-1,4-dithiine?
2-thiophen-2-yl-1,4-dithiine has a molecular weight of 198.34 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-yl-1,4-dithiine is sourced from PubChem (CID 66995291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).