C49H29N5S6 — CID 102326398
2,6-bis[5-[6-[5-(6-thiophen-2-yl-2-pyridinyl)thiophen-2-yl]-2-pyridinyl]thiophen-2-yl]pyridine (PubChem CID 102326398) has the molecular formula C49H29N5S6 and a molecular weight of 880.21 g/mol. Its IUPAC name is 2,6-bis[5-[6-[5-(6-thiophen-2-yl-2-pyridinyl)thiophen-2-yl]-2-pyridinyl]thiophen-2-yl]pyridine.
| Compound Name | 2,6-bis[5-[6-[5-(6-thiophen-2-yl-2-pyridinyl)thiophen-2-yl]-2-pyridinyl]thiophen-2-yl]pyridine |
|---|---|
| PubChem CID | 102326398 |
| Molecular Formula | C49H29N5S6 |
| Molecular Weight | 880.21 g/mol |
| Exact Mass | 879.07 |
| IUPAC Name | 2,6-bis[5-[6-[5-(6-thiophen-2-yl-2-pyridinyl)thiophen-2-yl]-2-pyridinyl]thiophen-2-yl]pyridine |
| SMILES | c1cc(-c2cccs2)nc(-c2ccc(-c3cccc(-c4ccc(-c5cccc(-c6ccc(-c7cccc(-c8ccc(-c9cccc(-c%10cccs%10)n9)s8)n7)s6)n5)s4)n3)s2)c1 |
| InChI | InChI=1S/C49H29N5S6/c1-8-30(40-18-6-28-55-40)50-32(10-1)42-20-22-44(57-42)34-12-3-14-36(52-34)46-24-26-48(59-46)38-16-5-17-39(54-38)49-27-25-47(60-49)37-15-4-13-35(53-37)45-23-21-43(58-45)33-11-2-9-31(51-33)41-19-7-29-56-41/h1-29H |
| InChIKey | OMGLRPCVMBOUCJ-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.21 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |