C26H18O2S4 — CID 155359471
(1Z,3E)-4-[4-(2,6-dithiophen-2-ylpyran-4-ylidene)-6-thiophen-2-ylpyran-2-yl]buta-1,3-diene-1-thiol (PubChem CID 155359471) has the molecular formula C26H18O2S4 and a molecular weight of 490.70 g/mol. Its IUPAC name is (1Z,3E)-4-[4-(2,6-dithiophen-2-ylpyran-4-ylidene)-6-thiophen-2-ylpyran-2-yl]buta-1,3-diene-1-thiol.
| Compound Name | (1Z,3E)-4-[4-(2,6-dithiophen-2-ylpyran-4-ylidene)-6-thiophen-2-ylpyran-2-yl]buta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 155359471 |
| Molecular Formula | C26H18O2S4 |
| Molecular Weight | 490.70 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | (1Z,3E)-4-[4-(2,6-dithiophen-2-ylpyran-4-ylidene)-6-thiophen-2-ylpyran-2-yl]buta-1,3-diene-1-thiol |
| SMILES | S/C=C\C=C\C1=CC(=C2C=C(c3cccs3)OC(c3cccs3)=C2)C=C(c2cccs2)O1 |
| InChI | InChI=1S/C26H18O2S4/c29-10-2-1-6-20-14-18(15-21(27-20)24-7-3-11-30-24)19-16-22(25-8-4-12-31-25)28-23(17-19)26-9-5-13-32-26/h1-17,29H/b6-1+,10-2- |
| InChIKey | IQTFEJBAVPVGGF-BHRIMUJLSA-N |
| XLogP | 8.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.70 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|