C48H40O2S2 — CID 102318746
4-[(2E,4E,6E,8E,10E)-12-(2,6-diphenylthiopyran-4-ylidene)-6,7-dimethoxydodeca-2,4,6,8,10-pentaenylidene]-2,6-diphenylthiopyran (PubChem CID 102318746) has the molecular formula C48H40O2S2 and a molecular weight of 712.98 g/mol. Its IUPAC name is 4-[(2E,4E,6E,8E,10E)-12-(2,6-diphenylthiopyran-4-ylidene)-6,7-dimethoxydodeca-2,4,6,8,10-pentaenylidene]-2,6-diphenylthiopyran.
| Compound Name | 4-[(2E,4E,6E,8E,10E)-12-(2,6-diphenylthiopyran-4-ylidene)-6,7-dimethoxydodeca-2,4,6,8,10-pentaenylidene]-2,6-diphenylthiopyran |
|---|---|
| PubChem CID | 102318746 |
| Molecular Formula | C48H40O2S2 |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.25 |
| IUPAC Name | 4-[(2E,4E,6E,8E,10E)-12-(2,6-diphenylthiopyran-4-ylidene)-6,7-dimethoxydodeca-2,4,6,8,10-pentaenylidene]-2,6-diphenylthiopyran |
| SMILES | COC(/C=C/C=C/C=C1C=C(c2ccccc2)SC(c2ccccc2)=C1)=C(\C=C\C=C\C=C1C=C(c2ccccc2)SC(c2ccccc2)=C1)OC |
| InChI | InChI=1S/C48H40O2S2/c1-49-43(31-19-3-9-21-37-33-45(39-23-11-5-12-24-39)51-46(34-37)40-25-13-6-14-26-40)44(50-2)32-20-4-10-22-38-35-47(41-27-15-7-16-28-41)52-48(36-38)42-29-17-8-18-30-42/h3-36H,1-2H3/b9-3+,10-4+,31-19+,32-20+,44-43+ |
| InChIKey | RYQBIDMBWJDHPE-AGPWUBETSA-N |
| XLogP | 13.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|