C40H32O2S2 — CID 177489702
(4Z)-4-[(2E,4E,6E,8Z)-4,5-dimethoxy-8-(2-phenylthiochromen-4-ylidene)octa-2,4,6-trienylidene]-2-phenylthiochromene (PubChem CID 177489702) has the molecular formula C40H32O2S2 and a molecular weight of 608.83 g/mol. Its IUPAC name is (4Z)-4-[(2E,4E,6E,8Z)-4,5-dimethoxy-8-(2-phenylthiochromen-4-ylidene)octa-2,4,6-trienylidene]-2-phenylthiochromene.
| Compound Name | (4Z)-4-[(2E,4E,6E,8Z)-4,5-dimethoxy-8-(2-phenylthiochromen-4-ylidene)octa-2,4,6-trienylidene]-2-phenylthiochromene |
|---|---|
| PubChem CID | 177489702 |
| Molecular Formula | C40H32O2S2 |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | (4Z)-4-[(2E,4E,6E,8Z)-4,5-dimethoxy-8-(2-phenylthiochromen-4-ylidene)octa-2,4,6-trienylidene]-2-phenylthiochromene |
| SMILES | COC(/C=C/C=C1/C=C(c2ccccc2)Sc2ccccc21)=C(\C=C\C=C1\C=C(c2ccccc2)Sc2ccccc21)OC |
| InChI | InChI=1S/C40H32O2S2/c1-41-35(23-13-19-31-27-39(29-15-5-3-6-16-29)43-37-25-11-9-21-33(31)37)36(42-2)24-14-20-32-28-40(30-17-7-4-8-18-30)44-38-26-12-10-22-34(32)38/h3-28H,1-2H3/b23-13+,24-14+,31-19-,32-20-,36-35+ |
| InChIKey | BPXJZMZENRTNLH-QJTDQXQOSA-N |
| XLogP | 11.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|