C19H13NS — CID 102074478
12-phenyl-11-thia-6-azatricyclo[8.5.0.02,8]pentadeca-1,3,5,7,9,12,14-heptaene (PubChem CID 102074478) has the molecular formula C19H13NS and a molecular weight of 287.39 g/mol. Its IUPAC name is 12-phenyl-11-thia-6-azatricyclo[8.5.0.02,8]pentadeca-1,3,5,7,9,12,14-heptaene.
| Compound Name | 12-phenyl-11-thia-6-azatricyclo[8.5.0.02,8]pentadeca-1,3,5,7,9,12,14-heptaene |
|---|---|
| PubChem CID | 102074478 |
| Molecular Formula | C19H13NS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 12-phenyl-11-thia-6-azatricyclo[8.5.0.02,8]pentadeca-1,3,5,7,9,12,14-heptaene |
| SMILES | C1=Cc2c(cc3cncccc2-3)SC(c2ccccc2)=C1 |
| InChI | InChI=1S/C19H13NS/c1-2-6-14(7-3-1)18-10-4-8-17-16-9-5-11-20-13-15(16)12-19(17)21-18/h1-13H |
| InChIKey | MYVOCAAUBZSDQY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |