C14H10N2S — CID 139696342
2-pyridin-4-yl-1,4-benzothiazepine (PubChem CID 139696342) has the molecular formula C14H10N2S and a molecular weight of 238.32 g/mol. Its IUPAC name is 2-pyridin-4-yl-1,4-benzothiazepine.
| Compound Name | 2-pyridin-4-yl-1,4-benzothiazepine |
|---|---|
| PubChem CID | 139696342 |
| Molecular Formula | C14H10N2S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-pyridin-4-yl-1,4-benzothiazepine |
| SMILES | C1=NC=C(c2ccncc2)Sc2ccccc21 |
| InChI | InChI=1S/C14H10N2S/c1-2-4-13-12(3-1)9-16-10-14(17-13)11-5-7-15-8-6-11/h1-10H |
| InChIKey | BFBWPHRZTSURPU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |