C18H14N2S — CID 71011962
10-methyl-3-pyridin-4-ylphenothiazine (PubChem CID 71011962) has the molecular formula C18H14N2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 10-methyl-3-pyridin-4-ylphenothiazine.
| Compound Name | 10-methyl-3-pyridin-4-ylphenothiazine |
|---|---|
| PubChem CID | 71011962 |
| Molecular Formula | C18H14N2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 10-methyl-3-pyridin-4-ylphenothiazine |
| SMILES | CN1c2ccccc2Sc2cc(-c3ccncc3)ccc21 |
| InChI | InChI=1S/C18H14N2S/c1-20-15-4-2-3-5-17(15)21-18-12-14(6-7-16(18)20)13-8-10-19-11-9-13/h2-12H,1H3 |
| InChIKey | KGSJANYEOBHRAU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |