C20H22SSi — CID 12887587
(2,6-diphenyl-4H-thiopyran-4-yl)-trimethylsilane (PubChem CID 12887587) has the molecular formula C20H22SSi and a molecular weight of 322.55 g/mol. Its IUPAC name is (2,6-diphenyl-4H-thiopyran-4-yl)-trimethylsilane.
| Compound Name | (2,6-diphenyl-4H-thiopyran-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 12887587 |
| Molecular Formula | C20H22SSi |
| Molecular Weight | 322.55 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (2,6-diphenyl-4H-thiopyran-4-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1C=C(c2ccccc2)SC(c2ccccc2)=C1 |
| InChI | InChI=1S/C20H22SSi/c1-22(2,3)18-14-19(16-10-6-4-7-11-16)21-20(15-18)17-12-8-5-9-13-17/h4-15,18H,1-3H3 |
| InChIKey | QKBDCAHQEIIPMT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|