C21H23O3PS — CID 12604720
4-diethoxyphosphoryl-2,6-diphenyl-4H-thiopyran (PubChem CID 12604720) has the molecular formula C21H23O3PS and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-2,6-diphenyl-4H-thiopyran.
| Compound Name | 4-diethoxyphosphoryl-2,6-diphenyl-4H-thiopyran |
|---|---|
| PubChem CID | 12604720 |
| Molecular Formula | C21H23O3PS |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 4-diethoxyphosphoryl-2,6-diphenyl-4H-thiopyran |
| SMILES | CCOP(=O)(OCC)C1C=C(c2ccccc2)SC(c2ccccc2)=C1 |
| InChI | InChI=1S/C21H23O3PS/c1-3-23-25(22,24-4-2)19-15-20(17-11-7-5-8-12-17)26-21(16-19)18-13-9-6-10-14-18/h5-16,19H,3-4H2,1-2H3 |
| InChIKey | NYHVUHUPBLEQOW-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|