C18H21N2O3PS — CID 101401394
2-diethoxyphosphoryl-5,5-diphenyl-2H-1,3,4-thiadiazole (PubChem CID 101401394) has the molecular formula C18H21N2O3PS and a molecular weight of 376.42 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-5,5-diphenyl-2H-1,3,4-thiadiazole.
| Compound Name | 2-diethoxyphosphoryl-5,5-diphenyl-2H-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 101401394 |
| Molecular Formula | C18H21N2O3PS |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-diethoxyphosphoryl-5,5-diphenyl-2H-1,3,4-thiadiazole |
| SMILES | CCOP(=O)(OCC)C1N=NC(c2ccccc2)(c2ccccc2)S1 |
| InChI | InChI=1S/C18H21N2O3PS/c1-3-22-24(21,23-4-2)17-19-20-18(25-17,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17H,3-4H2,1-2H3 |
| InChIKey | GYEXGMNAMMAQRA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|