C23H31NO5P2 — CID 12948202
4-diethoxyphosphoryl-2-methoxy-5,5-diphenyl-3-propan-2-ylidene-1,2λ5-azaphospholidine 2-oxide (PubChem CID 12948202) has the molecular formula C23H31NO5P2 and a molecular weight of 463.45 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-2-methoxy-5,5-diphenyl-3-propan-2-ylidene-1,2λ5-azaphospholidine 2-oxide.
| Compound Name | 4-diethoxyphosphoryl-2-methoxy-5,5-diphenyl-3-propan-2-ylidene-1,2λ5-azaphospholidine 2-oxide |
|---|---|
| PubChem CID | 12948202 |
| Molecular Formula | C23H31NO5P2 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 4-diethoxyphosphoryl-2-methoxy-5,5-diphenyl-3-propan-2-ylidene-1,2λ5-azaphospholidine 2-oxide |
| SMILES | CCOP(=O)(OCC)C1C(=C(C)C)P(=O)(OC)NC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO5P2/c1-6-28-31(26,29-7-2)22-21(18(3)4)30(25,27-5)24-23(22,19-14-10-8-11-15-19)20-16-12-9-13-17-20/h8-17,22H,6-7H2,1-5H3,(H,24,25) |
| InChIKey | TZUCZCZLLRLPPM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|