C24H31O7P — CID 11419838
3-diethoxyphosphoryloxy-3-(2,2-diphenylcyclopropyl)-2-methoxy-2-methylpropanoic acid (PubChem CID 11419838) has the molecular formula C24H31O7P and a molecular weight of 462.48 g/mol. Its IUPAC name is 3-diethoxyphosphoryloxy-3-(2,2-diphenylcyclopropyl)-2-methoxy-2-methylpropanoic acid.
| Compound Name | 3-diethoxyphosphoryloxy-3-(2,2-diphenylcyclopropyl)-2-methoxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11419838 |
| Molecular Formula | C24H31O7P |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 3-diethoxyphosphoryloxy-3-(2,2-diphenylcyclopropyl)-2-methoxy-2-methylpropanoic acid |
| SMILES | CCOP(=O)(OCC)OC(C1CC1(c1ccccc1)c1ccccc1)C(C)(OC)C(=O)O |
| InChI | InChI=1S/C24H31O7P/c1-5-29-32(27,30-6-2)31-21(23(3,28-4)22(25)26)20-17-24(20,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-16,20-21H,5-6,17H2,1-4H3,(H,25,26) |
| InChIKey | SQGOVPBECPGILS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|