C12H20Br3O6P — CID 19796895
2,2-dimethyl-3-(2,2,2-tribromo-1-diethoxyphosphoryloxyethyl)cyclopropane-1-carboxylic acid (PubChem CID 19796895) has the molecular formula C12H20Br3O6P and a molecular weight of 530.97 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,2,2-tribromo-1-diethoxyphosphoryloxyethyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-3-(2,2,2-tribromo-1-diethoxyphosphoryloxyethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 19796895 |
| Molecular Formula | C12H20Br3O6P |
| Molecular Weight | 530.97 g/mol |
| Exact Mass | 527.85 |
| IUPAC Name | 2,2-dimethyl-3-(2,2,2-tribromo-1-diethoxyphosphoryloxyethyl)cyclopropane-1-carboxylic acid |
| SMILES | CCOP(=O)(OCC)OC(C1C(C(=O)O)C1(C)C)C(Br)(Br)Br |
| InChI | InChI=1S/C12H20Br3O6P/c1-5-19-22(18,20-6-2)21-9(12(13,14)15)7-8(10(16)17)11(7,3)4/h7-9H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | XEYFYNHOITYHCC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.97 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|