C10H10Br3F3O4 — CID 57281245
cis-(1R,3S)-2,2-dimethyl-3-[(1S)-2,2,2-tribromo-1-(2,2,2-trifluoroacetyl)oxyethyl]cyclopropane-1-carboxylic acid (PubChem CID 57281245) has the molecular formula C10H10Br3F3O4 and a molecular weight of 490.89 g/mol. Its IUPAC name is cis-(1R,3S)-2,2-dimethyl-3-[(1S)-2,2,2-tribromo-1-(2,2,2-trifluoroacetyl)oxyethyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-2,2-dimethyl-3-[(1S)-2,2,2-tribromo-1-(2,2,2-trifluoroacetyl)oxyethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57281245 |
| Molecular Formula | C10H10Br3F3O4 |
| Molecular Weight | 490.89 g/mol |
| Exact Mass | 487.81 |
| IUPAC Name | cis-(1R,3S)-2,2-dimethyl-3-[(1S)-2,2,2-tribromo-1-(2,2,2-trifluoroacetyl)oxyethyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@@H]([C@H](OC(=O)C(F)(F)F)C(Br)(Br)Br)[C@H]1C(=O)O |
| InChI | InChI=1S/C10H10Br3F3O4/c1-8(2)3(4(8)6(17)18)5(9(11,12)13)20-7(19)10(14,15)16/h3-5H,1-2H3,(H,17,18)/t3-,4+,5+/m1/s1 |
| InChIKey | GKKSNPLTIRTOCO-WISUUJSJSA-N |
| XLogP | 3.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|