C10H13Cl3O4 — CID 18639320
3-[(1R)-1-acetyloxy-2,2,2-trichloroethyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 18639320) has the molecular formula C10H13Cl3O4 and a molecular weight of 303.57 g/mol. Its IUPAC name is 3-[(1R)-1-acetyloxy-2,2,2-trichloroethyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-[(1R)-1-acetyloxy-2,2,2-trichloroethyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 18639320 |
| Molecular Formula | C10H13Cl3O4 |
| Molecular Weight | 303.57 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 3-[(1R)-1-acetyloxy-2,2,2-trichloroethyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC(=O)O[C@H](C1C(C(=O)O)C1(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H13Cl3O4/c1-4(14)17-7(10(11,12)13)5-6(8(15)16)9(5,2)3/h5-7H,1-3H3,(H,15,16)/t5?,6?,7-/m1/s1 |
| InChIKey | YCBCMEPGQFDBMQ-KPGICGJXSA-N |
| XLogP | 2.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|