C8H10Br4O2 — CID 70508572
(3S)-2,2-dimethyl-3-[(1R)-1,2,2,2-tetrabromoethyl]cyclopropane-1-carboxylic acid (PubChem CID 70508572) has the molecular formula C8H10Br4O2 and a molecular weight of 457.78 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-3-[(1R)-1,2,2,2-tetrabromoethyl]cyclopropane-1-carboxylic acid.
| Compound Name | (3S)-2,2-dimethyl-3-[(1R)-1,2,2,2-tetrabromoethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70508572 |
| Molecular Formula | C8H10Br4O2 |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 453.74 |
| IUPAC Name | (3S)-2,2-dimethyl-3-[(1R)-1,2,2,2-tetrabromoethyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C(=O)O)[C@@H]1[C@@H](Br)C(Br)(Br)Br |
| InChI | InChI=1S/C8H10Br4O2/c1-7(2)3(4(7)6(13)14)5(9)8(10,11)12/h3-5H,1-2H3,(H,13,14)/t3-,4?,5-/m1/s1 |
| InChIKey | VSBCUTLTLUSECJ-MCZAYYIJSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|