C8H9Br2Cl3O — CID 88728532
(3S)-3-[(1R)-1,2-dibromo-2,2-dichloroethyl]-2,2-dimethylcyclopropane-1-carbonyl chloride (PubChem CID 88728532) has the molecular formula C8H9Br2Cl3O and a molecular weight of 387.33 g/mol. Its IUPAC name is (3S)-3-[(1R)-1,2-dibromo-2,2-dichloroethyl]-2,2-dimethylcyclopropane-1-carbonyl chloride.
| Compound Name | (3S)-3-[(1R)-1,2-dibromo-2,2-dichloroethyl]-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 88728532 |
| Molecular Formula | C8H9Br2Cl3O |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 383.81 |
| IUPAC Name | (3S)-3-[(1R)-1,2-dibromo-2,2-dichloroethyl]-2,2-dimethylcyclopropane-1-carbonyl chloride |
| SMILES | CC1(C)C(C(=O)Cl)[C@@H]1[C@@H](Br)C(Cl)(Cl)Br |
| InChI | InChI=1S/C8H9Br2Cl3O/c1-7(2)3(4(7)6(11)14)5(9)8(10,12)13/h3-5H,1-2H3/t3-,4?,5-/m1/s1 |
| InChIKey | PTWUJNIBSWMQFA-MCZAYYIJSA-N |
| XLogP | 4.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|