C8H10Cl4O — CID 12901011
2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carbonyl chloride (PubChem CID 12901011) has the molecular formula C8H10Cl4O and a molecular weight of 263.98 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carbonyl chloride.
| Compound Name | 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 12901011 |
| Molecular Formula | C8H10Cl4O |
| Molecular Weight | 263.98 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carbonyl chloride |
| SMILES | CC1(C)C(CC(Cl)(Cl)Cl)C1C(=O)Cl |
| InChI | InChI=1S/C8H10Cl4O/c1-7(2)4(3-8(10,11)12)5(7)6(9)13/h4-5H,3H2,1-2H3 |
| InChIKey | PQPIXVUKRIOQBG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.98 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|