C18H20Cl4O2 — CID 54328477
(3-chloro-4-phenylbut-2-enyl) 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate (PubChem CID 54328477) has the molecular formula C18H20Cl4O2 and a molecular weight of 410.17 g/mol. Its IUPAC name is (3-chloro-4-phenylbut-2-enyl) 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate.
| Compound Name | (3-chloro-4-phenylbut-2-enyl) 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54328477 |
| Molecular Formula | C18H20Cl4O2 |
| Molecular Weight | 410.17 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | (3-chloro-4-phenylbut-2-enyl) 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
| SMILES | CC1(C)C(CC(Cl)(Cl)Cl)C1C(=O)OCC=C(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C18H20Cl4O2/c1-17(2)14(11-18(20,21)22)15(17)16(23)24-9-8-13(19)10-12-6-4-3-5-7-12/h3-8,14-15H,9-11H2,1-2H3 |
| InChIKey | SWQHIUQQARGBFF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.17 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|