C22H22Cl3NO3S — CID 57144086
cis-[2-amino-1-(3-phenoxyphenyl)-2-sulfanylideneethyl] (1R,3R)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate (PubChem CID 57144086) has the molecular formula C22H22Cl3NO3S and a molecular weight of 486.85 g/mol. Its IUPAC name is cis-[2-amino-1-(3-phenoxyphenyl)-2-sulfanylideneethyl] (1R,3R)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate.
| Compound Name | cis-[2-amino-1-(3-phenoxyphenyl)-2-sulfanylideneethyl] (1R,3R)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57144086 |
| Molecular Formula | C22H22Cl3NO3S |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | cis-[2-amino-1-(3-phenoxyphenyl)-2-sulfanylideneethyl] (1R,3R)-2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](CC(Cl)(Cl)Cl)[C@H]1C(=O)OC(C(N)=S)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H22Cl3NO3S/c1-21(2)16(12-22(23,24)25)17(21)20(27)29-18(19(26)30)13-7-6-10-15(11-13)28-14-8-4-3-5-9-14/h3-11,16-18H,12H2,1-2H3,(H2,26,30)/t16-,17+,18?/m1/s1 |
| InChIKey | BFNBRCJNOQRKIJ-DVKDBIPTSA-N |
| XLogP | 6.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|