C23H20BrCl3O3 — CID 54432459
1-[3-(4-bromophenoxy)phenyl]prop-2-ynyl 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate (PubChem CID 54432459) has the molecular formula C23H20BrCl3O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 1-[3-(4-bromophenoxy)phenyl]prop-2-ynyl 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate.
| Compound Name | 1-[3-(4-bromophenoxy)phenyl]prop-2-ynyl 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54432459 |
| Molecular Formula | C23H20BrCl3O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 527.97 |
| IUPAC Name | 1-[3-(4-bromophenoxy)phenyl]prop-2-ynyl 2,2-dimethyl-3-(2,2,2-trichloroethyl)cyclopropane-1-carboxylate |
| SMILES | C#CC(OC(=O)C1C(CC(Cl)(Cl)Cl)C1(C)C)c1cccc(Oc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C23H20BrCl3O3/c1-4-19(30-21(28)20-18(22(20,2)3)13-23(25,26)27)14-6-5-7-17(12-14)29-16-10-8-15(24)9-11-16/h1,5-12,18-20H,13H2,2-3H3 |
| InChIKey | WIKWJVHEPYWSCT-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|