C22H21Br2NO3 — CID 118041385
cis-[cyano-(3-phenoxyphenyl)methyl] (1S,3S)-3-(2,2-dibromoethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 118041385) has the molecular formula C22H21Br2NO3 and a molecular weight of 507.22 g/mol. Its IUPAC name is cis-[cyano-(3-phenoxyphenyl)methyl] (1S,3S)-3-(2,2-dibromoethyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-[cyano-(3-phenoxyphenyl)methyl] (1S,3S)-3-(2,2-dibromoethyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 118041385 |
| Molecular Formula | C22H21Br2NO3 |
| Molecular Weight | 507.22 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | cis-[cyano-(3-phenoxyphenyl)methyl] (1S,3S)-3-(2,2-dibromoethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@@H](CC(Br)Br)[C@@H]1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H21Br2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-11,17-20H,12H2,1-2H3/t17-,18?,20+/m0/s1 |
| InChIKey | WGZYHSKZOYHGHU-NKUTVCTDSA-N |
| XLogP | 6.36 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.22 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|