C23H21Br2NO4 — CID 139635745
[(S)-cyano-(3-phenoxyphenyl)methyl] 3-(1,3-dibromo-2-oxopropyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 139635745) has the molecular formula C23H21Br2NO4 and a molecular weight of 535.23 g/mol. Its IUPAC name is [(S)-cyano-(3-phenoxyphenyl)methyl] 3-(1,3-dibromo-2-oxopropyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | [(S)-cyano-(3-phenoxyphenyl)methyl] 3-(1,3-dibromo-2-oxopropyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139635745 |
| Molecular Formula | C23H21Br2NO4 |
| Molecular Weight | 535.23 g/mol |
| Exact Mass | 532.98 |
| IUPAC Name | [(S)-cyano-(3-phenoxyphenyl)methyl] 3-(1,3-dibromo-2-oxopropyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C(=O)O[C@H](C#N)c2cccc(Oc3ccccc3)c2)C1C(Br)C(=O)CBr |
| InChI | InChI=1S/C23H21Br2NO4/c1-23(2)19(21(25)17(27)12-24)20(23)22(28)30-18(13-26)14-7-6-10-16(11-14)29-15-8-4-3-5-9-15/h3-11,18-21H,12H2,1-2H3/t18-,19?,20?,21?/m1/s1 |
| InChIKey | XWMCJRDFLFIJQL-YXOXRFPUSA-N |
| XLogP | 5.59 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.23 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|