C26H28N2O4S — CID 88775984
[2-amino-1-(3-phenoxyphenyl)-2-sulfanylideneethyl] 2,2-dimethyl-3-[(2E)-2-prop-2-ynoxyiminopropyl]cyclopropane-1-carboxylate (PubChem CID 88775984) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is [2-amino-1-(3-phenoxyphenyl)-2-sulfanylideneethyl] 2,2-dimethyl-3-[(2E)-2-prop-2-ynoxyiminopropyl]cyclopropane-1-carboxylate.
| Compound Name | [2-amino-1-(3-phenoxyphenyl)-2-sulfanylideneethyl] 2,2-dimethyl-3-[(2E)-2-prop-2-ynoxyiminopropyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88775984 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [2-amino-1-(3-phenoxyphenyl)-2-sulfanylideneethyl] 2,2-dimethyl-3-[(2E)-2-prop-2-ynoxyiminopropyl]cyclopropane-1-carboxylate |
| SMILES | C#CCO/N=C(\C)CC1C(C(=O)OC(C(N)=S)c2cccc(Oc3ccccc3)c2)C1(C)C |
| InChI | InChI=1S/C26H28N2O4S/c1-5-14-30-28-17(2)15-21-22(26(21,3)4)25(29)32-23(24(27)33)18-10-9-13-20(16-18)31-19-11-7-6-8-12-19/h1,6-13,16,21-23H,14-15H2,2-4H3,(H2,27,33)/b28-17+ |
| InChIKey | HWZUOOAYYPOOEL-OGLMXYFKSA-N |
| XLogP | 5.04 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|